C31H38O4 — CID 72980936
4'-ethenyl-4',11-dimethyl-8-(6-methylhept-5-en-2-yl)-2-phenylspiro[3-oxatricyclo[5.4.0.02,6]undec-10-ene-4,3'-oxolane]-2',5-dione (PubChem CID 72980936) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is 4'-ethenyl-4',11-dimethyl-8-(6-methylhept-5-en-2-yl)-2-phenylspiro[3-oxatricyclo[5.4.0.02,6]undec-10-ene-4,3'-oxolane]-2',5-dione.
| Compound Name | 4'-ethenyl-4',11-dimethyl-8-(6-methylhept-5-en-2-yl)-2-phenylspiro[3-oxatricyclo[5.4.0.02,6]undec-10-ene-4,3'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 72980936 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 4'-ethenyl-4',11-dimethyl-8-(6-methylhept-5-en-2-yl)-2-phenylspiro[3-oxatricyclo[5.4.0.02,6]undec-10-ene-4,3'-oxolane]-2',5-dione |
| SMILES | C=CC1(C)COC(=O)C12OC1(c3ccccc3)C(C2=O)C2C(C(C)CCC=C(C)C)CC=C(C)C21 |
| InChI | InChI=1S/C31H38O4/c1-7-29(6)18-34-28(33)31(29)27(32)26-24-23(20(4)13-11-12-19(2)3)17-16-21(5)25(24)30(26,35-31)22-14-9-8-10-15-22/h7-10,12,14-16,20,23-26H,1,11,13,17-18H2,2-6H3 |
| InChIKey | HPOOJUSGIAKESV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|