C21H17NO5S — CID 7298097
[2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] benzenesulfonate (PubChem CID 7298097) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] benzenesulfonate.
| Compound Name | [2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 7298097 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [2-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccccc1OS(=O)(=O)c1ccccc1)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C21H17NO5S/c23-20-18-13-10-11-14(12-13)19(18)21(24)22(20)16-8-4-5-9-17(16)27-28(25,26)15-6-2-1-3-7-15/h1-11,13-14,18-19H,12H2/t13-,14+,18-,19+ |
| InChIKey | ZZTMQFYXUCRZOR-SLDRDFCHSA-N |
| XLogP | 2.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|