C15H15ClN3O3- — CID 7298444
4-[4-[[2-(4-chlorophenyl)acetyl]amino]pyrazol-1-yl]butanoate (PubChem CID 7298444) has the molecular formula C15H15ClN3O3- and a molecular weight of 320.76 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)acetyl]amino]pyrazol-1-yl]butanoate.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)acetyl]amino]pyrazol-1-yl]butanoate |
|---|---|
| PubChem CID | 7298444 |
| Molecular Formula | C15H15ClN3O3- |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)acetyl]amino]pyrazol-1-yl]butanoate |
| SMILES | O=C([O-])CCCn1cc(NC(=O)Cc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C15H16ClN3O3/c16-12-5-3-11(4-6-12)8-14(20)18-13-9-17-19(10-13)7-1-2-15(21)22/h3-6,9-10H,1-2,7-8H2,(H,18,20)(H,21,22)/p-1 |
| InChIKey | HPKVFSCNSOEMBF-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |