C22H22ClNO2 — CID 72986189
3-(5-chloro-2-phenyl-1-benzofuran-3-yl)-N,N-diethylbut-2-enamide (PubChem CID 72986189) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 3-(5-chloro-2-phenyl-1-benzofuran-3-yl)-N,N-diethylbut-2-enamide.
| Compound Name | 3-(5-chloro-2-phenyl-1-benzofuran-3-yl)-N,N-diethylbut-2-enamide |
|---|---|
| PubChem CID | 72986189 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-(5-chloro-2-phenyl-1-benzofuran-3-yl)-N,N-diethylbut-2-enamide |
| SMILES | CCN(CC)C(=O)C=C(C)c1c(-c2ccccc2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H22ClNO2/c1-4-24(5-2)20(25)13-15(3)21-18-14-17(23)11-12-19(18)26-22(21)16-9-7-6-8-10-16/h6-14H,4-5H2,1-3H3 |
| InChIKey | WWCNCCPBNVWQJW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|