About 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide
2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide (PubChem CID 72986217) has the molecular formula C20H15ClF2N2O
and a molecular weight of 372.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide |
| PubChem CID | 72986217 |
| Molecular Formula | C20H15ClF2N2O |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide |
| SMILES | NC(=NO)C(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C20H15ClF2N2O/c21-18-4-2-1-3-17(18)20(19(24)25-26,13-5-9-15(22)10-6-13)14-7-11-16(23)12-8-14/h1-12,26H,(H2,24,25) |
| InChIKey | BYMVMERQSJVEEQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide?
The IUPAC name of 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide (CID 72986217) is 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide?
The canonical SMILES for 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide is NC(=NO)C(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccccc1Cl.
What is the InChIKey of 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide?
The InChIKey is BYMVMERQSJVEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClF2N2O/c21-18-4-2-1-3-17(18)20(19(24)25-26,13-5-9-15(22)10-6-13)14-7-11-16(23)12-8-14/h1-12,26H,(H2,24,25).
What are the key properties of 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide?
2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide has a molecular weight of 372.80 g/mol, XLogP of 4.70, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-2,2-bis(4-fluorophenyl)-N'-hydroxyethanimidamide is sourced from PubChem (CID 72986217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).