C48H78O10 — CID 72987793
1,7,15-trihydroxy-4,6,10,16,22,28-hexamethyl-13-(7,9,11-trihydroxy-4,10-dimethyltridec-4-en-2-yl)-12,29-dioxabicyclo[23.3.1]nonacosa-3,5,9,17,19-pentaene-11,23-dione (PubChem CID 72987793) has the molecular formula C48H78O10 and a molecular weight of 815.14 g/mol. Its IUPAC name is 1,7,15-trihydroxy-4,6,10,16,22,28-hexamethyl-13-(7,9,11-trihydroxy-4,10-dimethyltridec-4-en-2-yl)-12,29-dioxabicyclo[23.3.1]nonacosa-3,5,9,17,19-pentaene-11,23-dione.
| Compound Name | 1,7,15-trihydroxy-4,6,10,16,22,28-hexamethyl-13-(7,9,11-trihydroxy-4,10-dimethyltridec-4-en-2-yl)-12,29-dioxabicyclo[23.3.1]nonacosa-3,5,9,17,19-pentaene-11,23-dione |
|---|---|
| PubChem CID | 72987793 |
| Molecular Formula | C48H78O10 |
| Molecular Weight | 815.14 g/mol |
| Exact Mass | 814.56 |
| IUPAC Name | 1,7,15-trihydroxy-4,6,10,16,22,28-hexamethyl-13-(7,9,11-trihydroxy-4,10-dimethyltridec-4-en-2-yl)-12,29-dioxabicyclo[23.3.1]nonacosa-3,5,9,17,19-pentaene-11,23-dione |
| SMILES | CCC(O)C(C)C(O)CC(O)CC=C(C)CC(C)C1CC(O)C(C)C=CC=CCC(C)C(=O)CC2CCC(C)C(O)(CC=C(C)C=C(C)C(O)CC=C(C)C(=O)O1)O2 |
| InChI | InChI=1S/C48H78O10/c1-11-41(50)38(10)45(54)27-39(49)20-17-30(2)26-36(8)46-29-44(53)33(5)16-14-12-13-15-32(4)43(52)28-40-21-19-37(9)48(56,58-40)24-23-31(3)25-35(7)42(51)22-18-34(6)47(55)57-46/h12-14,16-18,23,25,32-33,36-42,44-46,49-51,53-54,56H,11,15,19-22,24,26-29H2,1-10H3 |
| InChIKey | WOCRMBMRJOSSHX-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.14 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|