About (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide
(Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide (PubChem CID 729911) has the molecular formula C10H6Cl2N2S
and a molecular weight of 257.15 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide.
Molecular Properties
| Compound Name | (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide |
| PubChem CID | 729911 |
| Molecular Formula | C10H6Cl2N2S |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide |
| SMILES | N#C/C(=C/c1cccc(Cl)c1Cl)C(N)=S |
| InChI | InChI=1S/C10H6Cl2N2S/c11-8-3-1-2-6(9(8)12)4-7(5-13)10(14)15/h1-4H,(H2,14,15)/b7-4- |
| InChIKey | WOJINVTZSNCBQC-DAXSKMNVSA-N |
| XLogP | 3.19 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide?
The IUPAC name of (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide (CID 729911) is (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide.
What is the SMILES notation for (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide?
The canonical SMILES for (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide is N#C/C(=C/c1cccc(Cl)c1Cl)C(N)=S.
What is the InChIKey of (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide?
The InChIKey is WOJINVTZSNCBQC-DAXSKMNVSA-N. The full InChI is InChI=1S/C10H6Cl2N2S/c11-8-3-1-2-6(9(8)12)4-7(5-13)10(14)15/h1-4H,(H2,14,15)/b7-4-.
What are the key properties of (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide?
(Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide has a molecular weight of 257.15 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enethioamide is sourced from PubChem (CID 729911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).