C11H11NO4 — CID 729942
(3S,4R)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione (PubChem CID 729942) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione.
| Compound Name | (3S,4R)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 729942 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (3S,4R)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione |
| SMILES | O=C1[C@@H](O)[C@@H](O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C11H11NO4/c13-8-9(14)11(16)12(10(8)15)6-7-4-2-1-3-5-7/h1-5,8-9,13-14H,6H2/t8-,9+ |
| InChIKey | IZBMPGFJNIDMRR-DTORHVGOSA-N |
| XLogP | -0.72 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|