C19H21F4N5O2 — CID 72994390
N-[5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]quinoxaline-2-carboxamide (PubChem CID 72994390) has the molecular formula C19H21F4N5O2 and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]quinoxaline-2-carboxamide.
| Compound Name | N-[5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 72994390 |
| Molecular Formula | C19H21F4N5O2 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]quinoxaline-2-carboxamide |
| SMILES | NC(CCCCNC(=O)c1cnc2ccccc2n1)C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C19H21F4N5O2/c20-18(21)10-28(11-19(18,22)23)17(30)12(24)5-3-4-8-25-16(29)15-9-26-13-6-1-2-7-14(13)27-15/h1-2,6-7,9,12H,3-5,8,10-11,24H2,(H,25,29) |
| InChIKey | JQTWMBHFTWRIAB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|