C19H18N4Na2O2S2 — CID 72994509
disodium;N,N'-bis(benzenecarbonothioyl)-N,N'-dimethylpropanedihydrazonate (PubChem CID 72994509) has the molecular formula C19H18N4Na2O2S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is disodium;N,N'-bis(benzenecarbonothioyl)-N,N'-dimethylpropanedihydrazonate.
| Compound Name | disodium;N,N'-bis(benzenecarbonothioyl)-N,N'-dimethylpropanedihydrazonate |
|---|---|
| PubChem CID | 72994509 |
| Molecular Formula | C19H18N4Na2O2S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | disodium;N,N'-bis(benzenecarbonothioyl)-N,N'-dimethylpropanedihydrazonate |
| SMILES | CN(N=C([O-])CC([O-])=NN(C)C(=S)c1ccccc1)C(=S)c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C19H20N4O2S2.2Na/c1-22(18(26)14-9-5-3-6-10-14)20-16(24)13-17(25)21-23(2)19(27)15-11-7-4-8-12-15;;/h3-12H,13H2,1-2H3,(H,20,24)(H,21,25);;/q;2*+1/p-2 |
| InChIKey | HHPFQODLMOUEFM-UHFFFAOYSA-L |
| XLogP | -4.65 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|