About 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid
4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid (PubChem CID 72996889) has the molecular formula C24H43NO3
and a molecular weight of 393.61 g/mol. Its IUPAC name is 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid.
Molecular Properties
| Compound Name | 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid |
| PubChem CID | 72996889 |
| Molecular Formula | C24H43NO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.32 |
| IUPAC Name | 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C24H43NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)25-22(24(27)28)20-21(2)3/h8-9,11-12,21-22H,4-7,10,13-20H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | CICRQSYFFGMUEH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid?
The IUPAC name of 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid (CID 72996889) is 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid.
What is the SMILES notation for 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid?
The canonical SMILES for 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid is CCCCCC=CCC=CCCCCCCCC(=O)NC(CC(C)C)C(=O)O.
What is the InChIKey of 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid?
The InChIKey is CICRQSYFFGMUEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H43NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)25-22(24(27)28)20-21(2)3/h8-9,11-12,21-22H,4-7,10,13-20H2,1-3H3,(H,25,26)(H,27,28).
What are the key properties of 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid?
4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid has a molecular weight of 393.61 g/mol, XLogP of 6.42, 18 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(octadeca-9,12-dienoylamino)pentanoic acid is sourced from PubChem (CID 72996889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).