C25H26N5O4+ — CID 72997308
[1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 72997308) has the molecular formula C25H26N5O4+ and a molecular weight of 460.51 g/mol. Its IUPAC name is [1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate.
| Compound Name | [1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate |
|---|---|
| PubChem CID | 72997308 |
| Molecular Formula | C25H26N5O4+ |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | C[N+]1(CC(=O)Nc2ncncn2)CCCC(OC(=O)C2(O)c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C25H25N5O4/c1-30(14-22(31)29-24-27-15-26-16-28-24)12-6-7-17(13-30)34-23(32)25(33)20-10-4-2-8-18(20)19-9-3-5-11-21(19)25/h2-5,8-11,15-17,33H,6-7,12-14H2,1H3/p+1 |
| InChIKey | BRVZAQFGVKDZKS-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|