C11H18O5 — CID 72998736
(2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanol (PubChem CID 72998736) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanol.
| Compound Name | (2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanol |
|---|---|
| PubChem CID | 72998736 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanol |
| SMILES | C=CCOC1C(CO)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C11H18O5/c1-4-5-13-8-7(6-12)14-10-9(8)15-11(2,3)16-10/h4,7-10,12H,1,5-6H2,2-3H3 |
| InChIKey | VQOBCTNSVGSHHH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|