C19H19BrNO4- — CID 7299900
5-bromo-2-[[2-[4-[(2S)-butan-2-yl]phenoxy]acetyl]amino]benzoate (PubChem CID 7299900) has the molecular formula C19H19BrNO4- and a molecular weight of 405.27 g/mol. Its IUPAC name is 5-bromo-2-[[2-[4-[(2S)-butan-2-yl]phenoxy]acetyl]amino]benzoate.
| Compound Name | 5-bromo-2-[[2-[4-[(2S)-butan-2-yl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7299900 |
| Molecular Formula | C19H19BrNO4- |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 5-bromo-2-[[2-[4-[(2S)-butan-2-yl]phenoxy]acetyl]amino]benzoate |
| SMILES | CC[C@H](C)c1ccc(OCC(=O)Nc2ccc(Br)cc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H20BrNO4/c1-3-12(2)13-4-7-15(8-5-13)25-11-18(22)21-17-9-6-14(20)10-16(17)19(23)24/h4-10,12H,3,11H2,1-2H3,(H,21,22)(H,23,24)/p-1/t12-/m0/s1 |
| InChIKey | UWXQYAXWSNBOTL-LBPRGKRZSA-M |
| XLogP | 3.34 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |