C9H16N6O4 — CID 73001424
2-amino-5-hydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol (PubChem CID 73001424) has the molecular formula C9H16N6O4 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-amino-5-hydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol.
| Compound Name | 2-amino-5-hydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
|---|---|
| PubChem CID | 73001424 |
| Molecular Formula | C9H16N6O4 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-amino-5-hydroxy-4-(hydroxymethyl)-6-imino-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
| SMILES | [H]/N=C1\N(O)C(CO)C2N=C(N)NC23N1CCC3(O)O |
| InChI | InChI=1S/C9H16N6O4/c10-6-12-5-4(3-16)15(19)7(11)14-2-1-8(17,18)9(5,14)13-6/h4-5,11,16-19H,1-3H2,(H3,10,12,13)/b11-7- |
| InChIKey | KUMXVBFFVVLQFX-XFFZJAGNSA-N |
| XLogP | -3.64 |
| TPSA | 161.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|