C19H24O4 — CID 73001624
3,14-dihydroxytetradeca-4,6,12-trien-8,10-diynyl 3-methylbutanoate (PubChem CID 73001624) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3,14-dihydroxytetradeca-4,6,12-trien-8,10-diynyl 3-methylbutanoate.
| Compound Name | 3,14-dihydroxytetradeca-4,6,12-trien-8,10-diynyl 3-methylbutanoate |
|---|---|
| PubChem CID | 73001624 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3,14-dihydroxytetradeca-4,6,12-trien-8,10-diynyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCCC(O)C=CC=CC#CC#CC=CCO |
| InChI | InChI=1S/C19H24O4/c1-17(2)16-19(22)23-15-13-18(21)12-10-8-6-4-3-5-7-9-11-14-20/h6,8-12,17-18,20-21H,13-16H2,1-2H3 |
| InChIKey | ILXATFYUJVFIQN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|