C27H29NO6 — CID 73005049
2-ethoxy-3-[3-[2-ethoxyimino-2-(4-phenoxyphenyl)ethoxy]phenyl]propanoic acid (PubChem CID 73005049) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-ethoxy-3-[3-[2-ethoxyimino-2-(4-phenoxyphenyl)ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[3-[2-ethoxyimino-2-(4-phenoxyphenyl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 73005049 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-ethoxy-3-[3-[2-ethoxyimino-2-(4-phenoxyphenyl)ethoxy]phenyl]propanoic acid |
| SMILES | CCON=C(COc1cccc(CC(OCC)C(=O)O)c1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO6/c1-3-31-26(27(29)30)18-20-9-8-12-24(17-20)32-19-25(28-33-4-2)21-13-15-23(16-14-21)34-22-10-6-5-7-11-22/h5-17,26H,3-4,18-19H2,1-2H3,(H,29,30) |
| InChIKey | RIZXBOUTBMVRPP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|