C29H44O7 — CID 73007790
[6-[(17-ethenyl-10-formyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate (PubChem CID 73007790) has the molecular formula C29H44O7 and a molecular weight of 504.66 g/mol. Its IUPAC name is [6-[(17-ethenyl-10-formyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [6-[(17-ethenyl-10-formyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 73007790 |
| Molecular Formula | C29H44O7 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | [6-[(17-ethenyl-10-formyl-13-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate |
| SMILES | C=CC1CCC2C3CCC4CC(OC5OC(C)C(OC(C)=O)C(O)C5O)CCC4(C=O)C3CCC12C |
| InChI | InChI=1S/C29H44O7/c1-5-18-7-9-22-21-8-6-19-14-20(10-13-29(19,15-30)23(21)11-12-28(18,22)4)36-27-25(33)24(32)26(16(2)34-27)35-17(3)31/h5,15-16,18-27,32-33H,1,6-14H2,2-4H3 |
| InChIKey | AIYZYMIXDUIBLQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|