About 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile
6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile (PubChem CID 73009367) has the molecular formula C17H14N4O2S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile |
| PubChem CID | 73009367 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile |
| SMILES | CC(C)Oc1c(C#N)cnc2ccc(C=C3SC(N)=NC3=O)cc12 |
| InChI | InChI=1S/C17H14N4O2S/c1-9(2)23-15-11(7-18)8-20-13-4-3-10(5-12(13)15)6-14-16(22)21-17(19)24-14/h3-6,8-9H,1-2H3,(H2,19,21,22) |
| InChIKey | AVDRGANXNDSQII-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile?
The IUPAC name of 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile (CID 73009367) is 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile.
What is the SMILES notation for 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile?
The canonical SMILES for 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile is CC(C)Oc1c(C#N)cnc2ccc(C=C3SC(N)=NC3=O)cc12.
What is the InChIKey of 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile?
The InChIKey is AVDRGANXNDSQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O2S/c1-9(2)23-15-11(7-18)8-20-13-4-3-10(5-12(13)15)6-14-16(22)21-17(19)24-14/h3-6,8-9H,1-2H3,(H2,19,21,22).
What are the key properties of 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile?
6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile has a molecular weight of 338.39 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-propan-2-yloxyquinoline-3-carbonitrile is sourced from PubChem (CID 73009367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).