About dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate
dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate (PubChem CID 73009815) has the molecular formula C13H16INO6
and a molecular weight of 409.18 g/mol. Its IUPAC name is dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate |
| PubChem CID | 73009815 |
| Molecular Formula | C13H16INO6 |
| Molecular Weight | 409.18 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate |
| SMILES | COC(=O)C1=CC2N(C(=O)OC)C(OC(=O)C2(C)C)C1I |
| InChI | InChI=1S/C13H16INO6/c1-13(2)7-5-6(10(16)19-3)8(14)9(21-11(13)17)15(7)12(18)20-4/h5,7-9H,1-4H3 |
| InChIKey | KFUIQOXYMGOZFO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate?
The IUPAC name of dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate (CID 73009815) is dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate.
What is the SMILES notation for dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate?
The canonical SMILES for dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate is COC(=O)C1=CC2N(C(=O)OC)C(OC(=O)C2(C)C)C1I.
What is the InChIKey of dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate?
The InChIKey is KFUIQOXYMGOZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16INO6/c1-13(2)7-5-6(10(16)19-3)8(14)9(21-11(13)17)15(7)12(18)20-4/h5,7-9H,1-4H3.
What are the key properties of dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate?
dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate has a molecular weight of 409.18 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 8-iodo-4,4-dimethyl-3-oxo-2-oxa-9-azabicyclo[3.3.1]non-6-ene-7,9-dicarboxylate is sourced from PubChem (CID 73009815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).