C12H20N3O7+ — CID 7301022
2-[(1R,5R)-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-en-3-yl]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 7301022) has the molecular formula C12H20N3O7+ and a molecular weight of 318.31 g/mol. Its IUPAC name is 2-[(1R,5R)-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-en-3-yl]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[(1R,5R)-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-en-3-yl]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 7301022 |
| Molecular Formula | C12H20N3O7+ |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[(1R,5R)-1,5-dinitro-3-azoniabicyclo[3.3.1]non-6-en-3-yl]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])[C@]12C=CC[C@]([N+](=O)[O-])(C[NH+](C(CO)(CO)CO)C1)C2 |
| InChI | InChI=1S/C12H19N3O7/c16-7-12(8-17,9-18)13-5-10(14(19)20)2-1-3-11(4-10,6-13)15(21)22/h1-2,16-18H,3-9H2/p+1/t10-,11+/m0/s1 |
| InChIKey | MBLCNFKZSXNSTQ-WDEREUQCSA-O |
| XLogP | -3.02 |
| TPSA | 151.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|