About 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole
2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 73011052) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 73011052 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C1=NCCN1 |
| InChI | InChI=1S/C15H22N2/c1-10-8-12(15(3,4)5)9-11(2)13(10)14-16-6-7-17-14/h8-9H,6-7H2,1-5H3,(H,16,17) |
| InChIKey | HSDHQMJMIKWBGQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole (CID 73011052) is 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole is Cc1cc(C(C)(C)C)cc(C)c1C1=NCCN1.
What is the InChIKey of 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole?
The InChIKey is HSDHQMJMIKWBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-10-8-12(15(3,4)5)9-11(2)13(10)14-16-6-7-17-14/h8-9H,6-7H2,1-5H3,(H,16,17).
What are the key properties of 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole?
2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole has a molecular weight of 230.35 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butyl-2,6-dimethylphenyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 73011052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).