About 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene
6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene (PubChem CID 73011360) has the molecular formula C12H8BrF3
and a molecular weight of 289.09 g/mol. Its IUPAC name is 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene |
| PubChem CID | 73011360 |
| Molecular Formula | C12H8BrF3 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene |
| SMILES | FC1=CC(c2ccccc2)=CC(F)C1(F)Br |
| InChI | InChI=1S/C12H8BrF3/c13-12(16)10(14)6-9(7-11(12)15)8-4-2-1-3-5-8/h1-7,10H |
| InChIKey | UGNJLKZSUIIXBP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene?
The IUPAC name of 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene (CID 73011360) is 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene.
What is the SMILES notation for 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene?
The canonical SMILES for 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene is FC1=CC(c2ccccc2)=CC(F)C1(F)Br.
What is the InChIKey of 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene?
The InChIKey is UGNJLKZSUIIXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrF3/c13-12(16)10(14)6-9(7-11(12)15)8-4-2-1-3-5-8/h1-7,10H.
What are the key properties of 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene?
6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene has a molecular weight of 289.09 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,5,6-trifluoro-3-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 73011360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).