About (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol
(2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol (PubChem CID 73012119) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol.
Molecular Properties
| Compound Name | (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol |
| PubChem CID | 73012119 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol |
| SMILES | CC1=NC(CO)C(C)N1 |
| InChI | InChI=1S/C6H12N2O/c1-4-6(3-9)8-5(2)7-4/h4,6,9H,3H2,1-2H3,(H,7,8) |
| InChIKey | QDGDOLDVTCZIDJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol?
The IUPAC name of (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol (CID 73012119) is (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol.
What is the SMILES notation for (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol?
The canonical SMILES for (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol is CC1=NC(CO)C(C)N1.
What is the InChIKey of (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol?
The InChIKey is QDGDOLDVTCZIDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-4-6(3-9)8-5(2)7-4/h4,6,9H,3H2,1-2H3,(H,7,8).
What are the key properties of (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol?
(2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol has a molecular weight of 128.17 g/mol, XLogP of -0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethyl-4,5-dihydro-1H-imidazol-4-yl)methanol is sourced from PubChem (CID 73012119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).