About 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde
4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde (PubChem CID 73012728) has the molecular formula C10H4ClF2NO2S
and a molecular weight of 275.66 g/mol. Its IUPAC name is 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 73012728 |
| Molecular Formula | C10H4ClF2NO2S |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(Oc2ccc(F)cc2F)nc1Cl |
| InChI | InChI=1S/C10H4ClF2NO2S/c11-9-8(4-15)17-10(14-9)16-7-2-1-5(12)3-6(7)13/h1-4H |
| InChIKey | VVACQVOVAQXABF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde (CID 73012728) is 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde is O=Cc1sc(Oc2ccc(F)cc2F)nc1Cl.
What is the InChIKey of 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde?
The InChIKey is VVACQVOVAQXABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4ClF2NO2S/c11-9-8(4-15)17-10(14-9)16-7-2-1-5(12)3-6(7)13/h1-4H.
What are the key properties of 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde?
4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde has a molecular weight of 275.66 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,4-difluorophenoxy)-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 73012728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).