About 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one
5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 73012862) has the molecular formula C7H5IN2OS2
and a molecular weight of 324.17 g/mol. Its IUPAC name is 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 73012862 |
| Molecular Formula | C7H5IN2OS2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.89 |
| IUPAC Name | 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CSc1nc2scc(I)c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H5IN2OS2/c1-12-7-9-5(11)4-3(8)2-13-6(4)10-7/h2H,1H3,(H,9,10,11) |
| InChIKey | FQGQJTIBDXPPKV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one (CID 73012862) is 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one is CSc1nc2scc(I)c2c(=O)[nH]1.
What is the InChIKey of 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is FQGQJTIBDXPPKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2OS2/c1-12-7-9-5(11)4-3(8)2-13-6(4)10-7/h2H,1H3,(H,9,10,11).
What are the key properties of 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one?
5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 324.17 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 73012862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).