About 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine
5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine (PubChem CID 73012954) has the molecular formula C19H22N4
and a molecular weight of 306.41 g/mol. Its IUPAC name is 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine |
| PubChem CID | 73012954 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(C)n2c(N3CCNCC3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C19H22N4/c1-14-8-9-15(2)23-18(14)21-17(16-6-4-3-5-7-16)19(23)22-12-10-20-11-13-22/h3-9,20H,10-13H2,1-2H3 |
| InChIKey | MYXVKNHPAIWWEH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine?
The IUPAC name of 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine (CID 73012954) is 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine.
What is the SMILES notation for 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine?
The canonical SMILES for 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine is Cc1ccc(C)n2c(N3CCNCC3)c(-c3ccccc3)nc12.
What is the InChIKey of 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine?
The InChIKey is MYXVKNHPAIWWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4/c1-14-8-9-15(2)23-18(14)21-17(16-6-4-3-5-7-16)19(23)22-12-10-20-11-13-22/h3-9,20H,10-13H2,1-2H3.
What are the key properties of 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine?
5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine has a molecular weight of 306.41 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethyl-2-phenyl-3-piperazin-1-ylimidazo[1,2-a]pyridine is sourced from PubChem (CID 73012954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).