About 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane
7-methylsulfonyl-2,7-diazaspiro[3.5]nonane (PubChem CID 73013724) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 73013724 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CS(=O)(=O)N1CCC2(CC1)CNC2 |
| InChI | InChI=1S/C8H16N2O2S/c1-13(11,12)10-4-2-8(3-5-10)6-9-7-8/h9H,2-7H2,1H3 |
| InChIKey | WRWIKWVLSYLALU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane (CID 73013724) is 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane is CS(=O)(=O)N1CCC2(CC1)CNC2.
What is the InChIKey of 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is WRWIKWVLSYLALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-13(11,12)10-4-2-8(3-5-10)6-9-7-8/h9H,2-7H2,1H3.
What are the key properties of 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane?
7-methylsulfonyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 204.29 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylsulfonyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 73013724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).