methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate

C10H12N2O4 — CID 73015633

IUPACmethyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate
SMILESCOC(=O)C=Cc1cnc(OC)nc1OC
InChIInChI=1S/C10H12N2O4/c1-14-8(13)5-4-7-6-11-10(16-3)12-9(7)15-2/h4-6H,1-3H3
InChIKeyIHMDWRWYNYKFCU-UHFFFAOYSA-N
MW224.22 g/mol
LogP0.68
Rot. Bonds4

About methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate

methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate (PubChem CID 73015633) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate
PubChem CID73015633
Molecular FormulaC10H12N2O4
Molecular Weight224.22 g/mol
Exact Mass224.08
IUPAC Namemethyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate
SMILESCOC(=O)C=Cc1cnc(OC)nc1OC
InChIInChI=1S/C10H12N2O4/c1-14-8(13)5-4-7-6-11-10(16-3)12-9(7)15-2/h4-6H,1-3H3
InChIKeyIHMDWRWYNYKFCU-UHFFFAOYSA-N
XLogP0.68
TPSA70.54 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.22
LogP ≤ 50.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate?
The IUPAC name of methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate (CID 73015633) is methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate.
What is the SMILES notation for methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate?
The canonical SMILES for methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate is COC(=O)C=Cc1cnc(OC)nc1OC.
What is the InChIKey of methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate?
The InChIKey is IHMDWRWYNYKFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c1-14-8(13)5-4-7-6-11-10(16-3)12-9(7)15-2/h4-6H,1-3H3.
What are the key properties of methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate?
methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate has a molecular weight of 224.22 g/mol, XLogP of 0.68, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoate is sourced from PubChem (CID 73015633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).