About 3-bromo-N,N-diethyl-4-methylbenzamide
3-bromo-N,N-diethyl-4-methylbenzamide (PubChem CID 730213) has the molecular formula C12H16BrNO
and a molecular weight of 270.17 g/mol. Its IUPAC name is 3-bromo-N,N-diethyl-4-methylbenzamide.
Molecular Properties
| Compound Name | 3-bromo-N,N-diethyl-4-methylbenzamide |
| PubChem CID | 730213 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-bromo-N,N-diethyl-4-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C12H16BrNO/c1-4-14(5-2)12(15)10-7-6-9(3)11(13)8-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | QJSVHRHJMMBKNQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-N,N-diethyl-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,N-diethyl-4-methylbenzamide?
The IUPAC name of 3-bromo-N,N-diethyl-4-methylbenzamide (CID 730213) is 3-bromo-N,N-diethyl-4-methylbenzamide.
What is the SMILES notation for 3-bromo-N,N-diethyl-4-methylbenzamide?
The canonical SMILES for 3-bromo-N,N-diethyl-4-methylbenzamide is CCN(CC)C(=O)c1ccc(C)c(Br)c1.
What is the InChIKey of 3-bromo-N,N-diethyl-4-methylbenzamide?
The InChIKey is QJSVHRHJMMBKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO/c1-4-14(5-2)12(15)10-7-6-9(3)11(13)8-10/h6-8H,4-5H2,1-3H3.
What are the key properties of 3-bromo-N,N-diethyl-4-methylbenzamide?
3-bromo-N,N-diethyl-4-methylbenzamide has a molecular weight of 270.17 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,N-diethyl-4-methylbenzamide is sourced from PubChem (CID 730213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).