C25H44O — CID 73023755
13,17,21-trimethyldocosa-12,16,20-trien-11-one (PubChem CID 73023755) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is 13,17,21-trimethyldocosa-12,16,20-trien-11-one.
| Compound Name | 13,17,21-trimethyldocosa-12,16,20-trien-11-one |
|---|---|
| PubChem CID | 73023755 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | 13,17,21-trimethyldocosa-12,16,20-trien-11-one |
| SMILES | CCCCCCCCCCC(=O)C=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C25H44O/c1-6-7-8-9-10-11-12-13-20-25(26)21-24(5)19-15-18-23(4)17-14-16-22(2)3/h16,18,21H,6-15,17,19-20H2,1-5H3 |
| InChIKey | PMRODDNBQZPVTE-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|