C13H15FOSi — CID 73025686
(6-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-1-yl)-trimethylsilane (PubChem CID 73025686) has the molecular formula C13H15FOSi and a molecular weight of 234.35 g/mol. Its IUPAC name is (6-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-1-yl)-trimethylsilane.
| Compound Name | (6-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 73025686 |
| Molecular Formula | C13H15FOSi |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (6-fluoro-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraen-1-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C12C=CC(O1)c1c(F)cccc12 |
| InChI | InChI=1S/C13H15FOSi/c1-16(2,3)13-8-7-11(15-13)12-9(13)5-4-6-10(12)14/h4-8,11H,1-3H3 |
| InChIKey | CITRJXOSXZJXAB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|