C18H18FNO2 — CID 73025898
ethyl 3-[2-(2-fluorophenyl)ethynyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 73025898) has the molecular formula C18H18FNO2 and a molecular weight of 299.34 g/mol. Its IUPAC name is ethyl 3-[2-(2-fluorophenyl)ethynyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | ethyl 3-[2-(2-fluorophenyl)ethynyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 73025898 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 3-[2-(2-fluorophenyl)ethynyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CCOC(=O)N1C2C=C(C#Cc3ccccc3F)CC1CC2 |
| InChI | InChI=1S/C18H18FNO2/c1-2-22-18(21)20-15-9-10-16(20)12-13(11-15)7-8-14-5-3-4-6-17(14)19/h3-6,11,15-16H,2,9-10,12H2,1H3 |
| InChIKey | LTVDJOSDEDVXHP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|