C16H23FOSi2 — CID 73025935
(3-fluoro-6-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)-trimethylsilane (PubChem CID 73025935) has the molecular formula C16H23FOSi2 and a molecular weight of 306.53 g/mol. Its IUPAC name is (3-fluoro-6-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)-trimethylsilane.
| Compound Name | (3-fluoro-6-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 73025935 |
| Molecular Formula | C16H23FOSi2 |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3-fluoro-6-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(F)c2c1C1C=CC2([Si](C)(C)C)O1 |
| InChI | InChI=1S/C16H23FOSi2/c1-19(2,3)13-8-7-11(17)15-14(13)12-9-10-16(15,18-12)20(4,5)6/h7-10,12H,1-6H3 |
| InChIKey | DGKMLLBQBCBDMO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|