C26H15F3N2O2S2 — CID 73027040
5-[[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]prop-1-ynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 73027040) has the molecular formula C26H15F3N2O2S2 and a molecular weight of 508.55 g/mol. Its IUPAC name is 5-[[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]prop-1-ynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]prop-1-ynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 73027040 |
| Molecular Formula | C26H15F3N2O2S2 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 5-[[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]prop-1-ynyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(C#CCN3c4ccccc4Sc4ccc(C(F)(F)F)cc43)cc2)S1 |
| InChI | InChI=1S/C26H15F3N2O2S2/c27-26(28,29)18-11-12-22-20(15-18)31(19-5-1-2-6-21(19)34-22)13-3-4-16-7-9-17(10-8-16)14-23-24(32)30-25(33)35-23/h1-2,5-12,14-15H,13H2,(H,30,32,33) |
| InChIKey | AQRBBSSMMBZGAK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|