C30H52O7 — CID 73027129
3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid (PubChem CID 73027129) has the molecular formula C30H52O7 and a molecular weight of 524.74 g/mol. Its IUPAC name is 3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid.
| Compound Name | 3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid |
|---|---|
| PubChem CID | 73027129 |
| Molecular Formula | C30H52O7 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | 3,7,11,15-tetrahydroxy-18-(hydroxymethyl)-2,4,6,10,14,16,20-heptamethyldocosa-4,8,12,16-tetraenoic acid |
| SMILES | CCC(C)CC(C=C(C)C(O)C(C)C=CC(O)C(C)C=CC(O)C(C)C=C(C)C(O)C(C)C(=O)O)CO |
| InChI | InChI=1S/C30H52O7/c1-9-18(2)14-25(17-31)16-23(7)28(34)20(4)11-13-26(32)19(3)10-12-27(33)21(5)15-22(6)29(35)24(8)30(36)37/h10-13,15-16,18-21,24-29,31-35H,9,14,17H2,1-8H3,(H,36,37) |
| InChIKey | UHSVRGKIDHLSHC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|