C27H35NO18 — CID 73030002
[4,5-diacetyloxy-6-isocyanato-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 73030002) has the molecular formula C27H35NO18 and a molecular weight of 661.57 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-isocyanato-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [4,5-diacetyloxy-6-isocyanato-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 73030002 |
| Molecular Formula | C27H35NO18 |
| Molecular Weight | 661.57 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | [4,5-diacetyloxy-6-isocyanato-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(N=C=O)C(OC(C)=O)C(OC(C)=O)C1OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C27H35NO18/c1-11(30)37-8-18-21(22(40-14(4)33)24(42-16(6)35)26(44-18)28-10-29)46-27-25(43-17(7)36)23(41-15(5)34)20(39-13(3)32)19(45-27)9-38-12(2)31/h18-27H,8-9H2,1-7H3 |
| InChIKey | KTBWUGAGUCYCJX-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 241.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.57 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|