C31H34N4O — CID 73031789
N-(3-aminopropyl)-N-[1-(1-benzyl-5-ethynylbenzimidazol-2-yl)-2-methylpropyl]-4-methylbenzamide (PubChem CID 73031789) has the molecular formula C31H34N4O and a molecular weight of 478.64 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[1-(1-benzyl-5-ethynylbenzimidazol-2-yl)-2-methylpropyl]-4-methylbenzamide.
| Compound Name | N-(3-aminopropyl)-N-[1-(1-benzyl-5-ethynylbenzimidazol-2-yl)-2-methylpropyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 73031789 |
| Molecular Formula | C31H34N4O |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-(3-aminopropyl)-N-[1-(1-benzyl-5-ethynylbenzimidazol-2-yl)-2-methylpropyl]-4-methylbenzamide |
| SMILES | C#Cc1ccc2c(c1)nc(C(C(C)C)N(CCCN)C(=O)c1ccc(C)cc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C31H34N4O/c1-5-24-14-17-28-27(20-24)33-30(35(28)21-25-10-7-6-8-11-25)29(22(2)3)34(19-9-18-32)31(36)26-15-12-23(4)13-16-26/h1,6-8,10-17,20,22,29H,9,18-19,21,32H2,2-4H3 |
| InChIKey | DCFCJPNUTQSCBS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|