C20H21Cl2NOS — CID 73033678
N-[4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ylidene]-2-methylpropane-2-sulfinamide (PubChem CID 73033678) has the molecular formula C20H21Cl2NOS and a molecular weight of 394.37 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 73033678 |
| Molecular Formula | C20H21Cl2NOS |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-ylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=C1CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C20H21Cl2NOS/c1-20(2,3)25(24)23-19-11-9-14(15-6-4-5-7-16(15)19)13-8-10-17(21)18(22)12-13/h4-8,10,12,14H,9,11H2,1-3H3 |
| InChIKey | QCZNDNJKGBTUIR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|