About 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane
2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane (PubChem CID 73033787) has the molecular formula C19H41O5PS
and a molecular weight of 412.57 g/mol. Its IUPAC name is 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane |
| PubChem CID | 73033787 |
| Molecular Formula | C19H41O5PS |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCCOCC(COP(O)(O)=S)OCCCCCCCC |
| InChI | InChI=1S/C19H41O5PS/c1-3-5-7-9-11-13-15-22-17-19(18-24-25(20,21)26)23-16-14-12-10-8-6-4-2/h19H,3-18H2,1-2H3,(H2,20,21,26) |
| InChIKey | PLCCQSPJUXGEHV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane?
The IUPAC name of 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane (CID 73033787) is 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane.
What is the SMILES notation for 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane?
The canonical SMILES for 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane is CCCCCCCCOCC(COP(O)(O)=S)OCCCCCCCC.
What is the InChIKey of 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane?
The InChIKey is PLCCQSPJUXGEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41O5PS/c1-3-5-7-9-11-13-15-22-17-19(18-24-25(20,21)26)23-16-14-12-10-8-6-4-2/h19H,3-18H2,1-2H3,(H2,20,21,26).
What are the key properties of 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane?
2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane has a molecular weight of 412.57 g/mol, XLogP of 5.33, 20 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dioctoxypropoxy-dihydroxy-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 73033787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).