About 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide
2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide (PubChem CID 73033826) has the molecular formula C12H4Cl2F6N4S
and a molecular weight of 421.15 g/mol. Its IUPAC name is 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide.
Molecular Properties
| Compound Name | 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide |
| PubChem CID | 73033826 |
| Molecular Formula | C12H4Cl2F6N4S |
| Molecular Weight | 421.15 g/mol |
| Exact Mass | 419.94 |
| IUPAC Name | 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide |
| SMILES | N#CC(=NNc1c(Cl)cc(C(F)(F)F)cc1Cl)C(C#N)SC(F)(F)F |
| InChI | InChI=1S/C12H4Cl2F6N4S/c13-6-1-5(11(15,16)17)2-7(14)10(6)24-23-8(3-21)9(4-22)25-12(18,19)20/h1-2,9,24H |
| InChIKey | VUKNHTVKQVHRSS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.15 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide?
The IUPAC name of 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide (CID 73033826) is 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide.
What is the SMILES notation for 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide?
The canonical SMILES for 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide is N#CC(=NNc1c(Cl)cc(C(F)(F)F)cc1Cl)C(C#N)SC(F)(F)F.
What is the InChIKey of 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide?
The InChIKey is VUKNHTVKQVHRSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Cl2F6N4S/c13-6-1-5(11(15,16)17)2-7(14)10(6)24-23-8(3-21)9(4-22)25-12(18,19)20/h1-2,9,24H.
What are the key properties of 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide?
2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide has a molecular weight of 421.15 g/mol, XLogP of 5.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[2,6-dichloro-4-(trifluoromethyl)anilino]-2-(trifluoromethylsulfanyl)ethanimidoyl cyanide is sourced from PubChem (CID 73033826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).