About N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine
N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine (PubChem CID 73036509) has the molecular formula C26H27BrN2O
and a molecular weight of 463.42 g/mol. Its IUPAC name is N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine.
Molecular Properties
| Compound Name | N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine |
| PubChem CID | 73036509 |
| Molecular Formula | C26H27BrN2O |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine |
| SMILES | CC1C(=NOCc2ccccc2Br)CC(c2ccccc2)N(C)C1c1ccccc1 |
| InChI | InChI=1S/C26H27BrN2O/c1-19-24(28-30-18-22-15-9-10-16-23(22)27)17-25(20-11-5-3-6-12-20)29(2)26(19)21-13-7-4-8-14-21/h3-16,19,25-26H,17-18H2,1-2H3 |
| InChIKey | KMFVBXILXCFEEJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine?
The IUPAC name of N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine (CID 73036509) is N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine.
What is the SMILES notation for N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine?
The canonical SMILES for N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine is CC1C(=NOCc2ccccc2Br)CC(c2ccccc2)N(C)C1c1ccccc1.
What is the InChIKey of N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine?
The InChIKey is KMFVBXILXCFEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27BrN2O/c1-19-24(28-30-18-22-15-9-10-16-23(22)27)17-25(20-11-5-3-6-12-20)29(2)26(19)21-13-7-4-8-14-21/h3-16,19,25-26H,17-18H2,1-2H3.
What are the key properties of N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine?
N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine has a molecular weight of 463.42 g/mol, XLogP of 6.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-bromophenyl)methoxy]-1,3-dimethyl-2,6-diphenylpiperidin-4-imine is sourced from PubChem (CID 73036509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).