C33H29N3O4 — CID 73036878
N-hydroxy-4-[2-[(4-phenylmethoxyphenoxy)methyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide (PubChem CID 73036878) has the molecular formula C33H29N3O4 and a molecular weight of 531.61 g/mol. Its IUPAC name is N-hydroxy-4-[2-[(4-phenylmethoxyphenoxy)methyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide.
| Compound Name | N-hydroxy-4-[2-[(4-phenylmethoxyphenoxy)methyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 73036878 |
| Molecular Formula | C33H29N3O4 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | N-hydroxy-4-[2-[(4-phenylmethoxyphenoxy)methyl]-3-(quinolin-3-ylamino)prop-1-enyl]benzamide |
| SMILES | O=C(NO)c1ccc(C=C(CNc2cnc3ccccc3c2)COc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H29N3O4/c37-33(36-38)27-12-10-24(11-13-27)18-26(20-34-29-19-28-8-4-5-9-32(28)35-21-29)23-40-31-16-14-30(15-17-31)39-22-25-6-2-1-3-7-25/h1-19,21,34,38H,20,22-23H2,(H,36,37) |
| InChIKey | GUTMWJGKKWZISS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|