C15H28N2O4 — CID 7303816
N'-[[(2R)-oxolan-2-yl]methyl]-N-(3-propan-2-yloxypropyl)butanediamide (PubChem CID 7303816) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is N'-[[(2R)-oxolan-2-yl]methyl]-N-(3-propan-2-yloxypropyl)butanediamide.
| Compound Name | N'-[[(2R)-oxolan-2-yl]methyl]-N-(3-propan-2-yloxypropyl)butanediamide |
|---|---|
| PubChem CID | 7303816 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N'-[[(2R)-oxolan-2-yl]methyl]-N-(3-propan-2-yloxypropyl)butanediamide |
| SMILES | CC(C)OCCCNC(=O)CCC(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C15H28N2O4/c1-12(2)20-10-4-8-16-14(18)6-7-15(19)17-11-13-5-3-9-21-13/h12-13H,3-11H2,1-2H3,(H,16,18)(H,17,19)/t13-/m1/s1 |
| InChIKey | VXOJGFPNBSMLAZ-CYBMUJFWSA-N |
| XLogP | 0.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|