C16H23F3O3 — CID 73040566
ethyl 2-octylidene-1-(2,2,2-trifluoroacetyl)cyclopropane-1-carboxylate (PubChem CID 73040566) has the molecular formula C16H23F3O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl 2-octylidene-1-(2,2,2-trifluoroacetyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-octylidene-1-(2,2,2-trifluoroacetyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 73040566 |
| Molecular Formula | C16H23F3O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl 2-octylidene-1-(2,2,2-trifluoroacetyl)cyclopropane-1-carboxylate |
| SMILES | CCCCCCCC=C1CC1(C(=O)OCC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H23F3O3/c1-3-5-6-7-8-9-10-12-11-15(12,14(21)22-4-2)13(20)16(17,18)19/h10H,3-9,11H2,1-2H3 |
| InChIKey | HLUGSUPXUSTHIJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|