C15H18N2O3S — CID 7304282
S-prop-2-enyl (1R,5S)-1-cyano-2,4-dioxo-3-azaspiro[5.5]undecane-5-carbothioate (PubChem CID 7304282) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is S-prop-2-enyl (1R,5S)-1-cyano-2,4-dioxo-3-azaspiro[5.5]undecane-5-carbothioate.
| Compound Name | S-prop-2-enyl (1R,5S)-1-cyano-2,4-dioxo-3-azaspiro[5.5]undecane-5-carbothioate |
|---|---|
| PubChem CID | 7304282 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | S-prop-2-enyl (1R,5S)-1-cyano-2,4-dioxo-3-azaspiro[5.5]undecane-5-carbothioate |
| SMILES | C=CCSC(=O)[C@@H]1C(=O)NC(=O)[C@@H](C#N)C12CCCCC2 |
| InChI | InChI=1S/C15H18N2O3S/c1-2-8-21-14(20)11-13(19)17-12(18)10(9-16)15(11)6-4-3-5-7-15/h2,10-11H,1,3-8H2,(H,17,18,19)/t10-,11+/m1/s1 |
| InChIKey | SEJGOFFHGXWZTN-MNOVXSKESA-N |
| XLogP | 1.80 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|