About N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine
N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine (PubChem CID 7304374) has the molecular formula C19H17Cl2N3OS
and a molecular weight of 406.34 g/mol. Its IUPAC name is N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine |
| PubChem CID | 7304374 |
| Molecular Formula | C19H17Cl2N3OS |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine |
| SMILES | Clc1ccc(/N=c2\scc(-c3ccc(Cl)cc3)n2N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H17Cl2N3OS/c20-15-3-1-14(2-4-15)18-13-26-19(22-17-7-5-16(21)6-8-17)24(18)23-9-11-25-12-10-23/h1-8,13H,9-12H2/b22-19- |
| InChIKey | LBZGGIBNXPICNQ-QOCHGBHMSA-N |
| XLogP | 4.72 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine?
The IUPAC name of N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine (CID 7304374) is N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine.
What is the SMILES notation for N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine?
The canonical SMILES for N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine is Clc1ccc(/N=c2\scc(-c3ccc(Cl)cc3)n2N2CCOCC2)cc1.
What is the InChIKey of N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine?
The InChIKey is LBZGGIBNXPICNQ-QOCHGBHMSA-N. The full InChI is InChI=1S/C19H17Cl2N3OS/c20-15-3-1-14(2-4-15)18-13-26-19(22-17-7-5-16(21)6-8-17)24(18)23-9-11-25-12-10-23/h1-8,13H,9-12H2/b22-19-.
What are the key properties of N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine?
N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine has a molecular weight of 406.34 g/mol, XLogP of 4.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-bis(4-chlorophenyl)-3-morpholin-4-yl-1,3-thiazol-2-imine is sourced from PubChem (CID 7304374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).