C22H30N3O3+ — CID 7304578
[4-[2-(cyclohexylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl-(pyridin-2-ylmethyl)azanium (PubChem CID 7304578) has the molecular formula C22H30N3O3+ and a molecular weight of 384.50 g/mol. Its IUPAC name is [4-[2-(cyclohexylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl-(pyridin-2-ylmethyl)azanium.
| Compound Name | [4-[2-(cyclohexylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl-(pyridin-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7304578 |
| Molecular Formula | C22H30N3O3+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [4-[2-(cyclohexylamino)-2-oxoethoxy]-3-methoxyphenyl]methyl-(pyridin-2-ylmethyl)azanium |
| SMILES | COc1cc(C[NH2+]Cc2ccccn2)ccc1OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H29N3O3/c1-27-21-13-17(14-23-15-19-9-5-6-12-24-19)10-11-20(21)28-16-22(26)25-18-7-3-2-4-8-18/h5-6,9-13,18,23H,2-4,7-8,14-16H2,1H3,(H,25,26)/p+1 |
| InChIKey | BQKNIIJFMQNCES-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 77.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |