C29H46O8 — CID 73046469
[4-acetyloxy-5-[(3-ethenyl-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl)methoxy]-3-hydroxyoxolan-2-yl]methyl acetate (PubChem CID 73046469) has the molecular formula C29H46O8 and a molecular weight of 522.68 g/mol. Its IUPAC name is [4-acetyloxy-5-[(3-ethenyl-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl)methoxy]-3-hydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [4-acetyloxy-5-[(3-ethenyl-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl)methoxy]-3-hydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 73046469 |
| Molecular Formula | C29H46O8 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | [4-acetyloxy-5-[(3-ethenyl-3,4a,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl)methoxy]-3-hydroxyoxolan-2-yl]methyl acetate |
| SMILES | C=CC1(C)CCC2C(C)(CCC3C(C)(COC4OC(COC(C)=O)C(O)C4OC(C)=O)CCCC32C)O1 |
| InChI | InChI=1S/C29H46O8/c1-8-27(5)14-10-22-28(6)13-9-12-26(4,21(28)11-15-29(22,7)37-27)17-34-25-24(35-19(3)31)23(32)20(36-25)16-33-18(2)30/h8,20-25,32H,1,9-17H2,2-7H3 |
| InChIKey | FHNHKTIZZUEYNI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|