About (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide
(3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide (PubChem CID 7304649) has the molecular formula C14H20FN2O2S+
and a molecular weight of 299.39 g/mol. Its IUPAC name is (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide |
| PubChem CID | 7304649 |
| Molecular Formula | C14H20FN2O2S+ |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H]([NH+]2CCN(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C14H19FN2O2S/c15-12-1-3-13(4-2-12)16-6-8-17(9-7-16)14-5-10-20(18,19)11-14/h1-4,14H,5-11H2/p+1/t14-/m1/s1 |
| InChIKey | DIEMLVRHXIZQGI-CQSZACIVSA-O |
| XLogP | -0.28 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide?
The IUPAC name of (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide (CID 7304649) is (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide.
What is the SMILES notation for (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide?
The canonical SMILES for (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide is O=S1(=O)CC[C@@H]([NH+]2CCN(c3ccc(F)cc3)CC2)C1.
What is the InChIKey of (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide?
The InChIKey is DIEMLVRHXIZQGI-CQSZACIVSA-O. The full InChI is InChI=1S/C14H19FN2O2S/c15-12-1-3-13(4-2-12)16-6-8-17(9-7-16)14-5-10-20(18,19)11-14/h1-4,14H,5-11H2/p+1/t14-/m1/s1.
What are the key properties of (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide?
(3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide has a molecular weight of 299.39 g/mol, XLogP of -0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 7304649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).